C8H6Br2N2O4S2 — CID 66083813
4-(2,5-dibromothiophen-3-yl)sulfonylpiperazine-2,6-dione (PubChem CID 66083813) has the molecular formula C8H6Br2N2O4S2 and a molecular weight of 418.09 g/mol. Its IUPAC name is 4-(2,5-dibromothiophen-3-yl)sulfonylpiperazine-2,6-dione.
| Compound Name | 4-(2,5-dibromothiophen-3-yl)sulfonylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66083813 |
| Molecular Formula | C8H6Br2N2O4S2 |
| Molecular Weight | 418.09 g/mol |
| Exact Mass | 415.81 |
| IUPAC Name | 4-(2,5-dibromothiophen-3-yl)sulfonylpiperazine-2,6-dione |
| SMILES | O=C1CN(S(=O)(=O)c2cc(Br)sc2Br)CC(=O)N1 |
| InChI | InChI=1S/C8H6Br2N2O4S2/c9-5-1-4(8(10)17-5)18(15,16)12-2-6(13)11-7(14)3-12/h1H,2-3H2,(H,11,13,14) |
| InChIKey | UTIDWRCCXJPHDF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.09 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|