C9H12Br2N2O2S2 — CID 104976633
(3S)-1-(2,5-dibromothiophen-3-yl)sulfonyl-3-methylpiperazine (PubChem CID 104976633) has the molecular formula C9H12Br2N2O2S2 and a molecular weight of 404.15 g/mol. Its IUPAC name is (3S)-1-(2,5-dibromothiophen-3-yl)sulfonyl-3-methylpiperazine.
| Compound Name | (3S)-1-(2,5-dibromothiophen-3-yl)sulfonyl-3-methylpiperazine |
|---|---|
| PubChem CID | 104976633 |
| Molecular Formula | C9H12Br2N2O2S2 |
| Molecular Weight | 404.15 g/mol |
| Exact Mass | 401.87 |
| IUPAC Name | (3S)-1-(2,5-dibromothiophen-3-yl)sulfonyl-3-methylpiperazine |
| SMILES | C[C@H]1CN(S(=O)(=O)c2cc(Br)sc2Br)CCN1 |
| InChI | InChI=1S/C9H12Br2N2O2S2/c1-6-5-13(3-2-12-6)17(14,15)7-4-8(10)16-9(7)11/h4,6,12H,2-3,5H2,1H3/t6-/m0/s1 |
| InChIKey | VOBUVLPKMVBFMI-LURJTMIESA-N |
| XLogP | 2.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.15 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |