C11H16Br2N2O2S2 — CID 55169537
1-[1-(2,5-dibromothiophen-3-yl)sulfonylpiperidin-2-yl]ethanamine (PubChem CID 55169537) has the molecular formula C11H16Br2N2O2S2 and a molecular weight of 432.20 g/mol. Its IUPAC name is 1-[1-(2,5-dibromothiophen-3-yl)sulfonylpiperidin-2-yl]ethanamine.
| Compound Name | 1-[1-(2,5-dibromothiophen-3-yl)sulfonylpiperidin-2-yl]ethanamine |
|---|---|
| PubChem CID | 55169537 |
| Molecular Formula | C11H16Br2N2O2S2 |
| Molecular Weight | 432.20 g/mol |
| Exact Mass | 429.90 |
| IUPAC Name | 1-[1-(2,5-dibromothiophen-3-yl)sulfonylpiperidin-2-yl]ethanamine |
| SMILES | CC(N)C1CCCCN1S(=O)(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C11H16Br2N2O2S2/c1-7(14)8-4-2-3-5-15(8)19(16,17)9-6-10(12)18-11(9)13/h6-8H,2-5,14H2,1H3 |
| InChIKey | CJCIOGLNRYGULG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.20 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |