C14H21BrN2O2S — CID 63254819
1-[1-(4-bromo-3-methylphenyl)sulfonylpiperidin-2-yl]ethanamine (PubChem CID 63254819) has the molecular formula C14H21BrN2O2S and a molecular weight of 361.31 g/mol. Its IUPAC name is 1-[1-(4-bromo-3-methylphenyl)sulfonylpiperidin-2-yl]ethanamine.
| Compound Name | 1-[1-(4-bromo-3-methylphenyl)sulfonylpiperidin-2-yl]ethanamine |
|---|---|
| PubChem CID | 63254819 |
| Molecular Formula | C14H21BrN2O2S |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 1-[1-(4-bromo-3-methylphenyl)sulfonylpiperidin-2-yl]ethanamine |
| SMILES | Cc1cc(S(=O)(=O)N2CCCCC2C(C)N)ccc1Br |
| InChI | InChI=1S/C14H21BrN2O2S/c1-10-9-12(6-7-13(10)15)20(18,19)17-8-4-3-5-14(17)11(2)16/h6-7,9,11,14H,3-5,8,16H2,1-2H3 |
| InChIKey | BCJHNASDTXXTTR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |