C16H27N3O2S — CID 119965411
5-[2-(1-aminoethyl)piperidin-1-yl]sulfonyl-N,N,2-trimethylaniline (PubChem CID 119965411) has the molecular formula C16H27N3O2S and a molecular weight of 325.48 g/mol. Its IUPAC name is 5-[2-(1-aminoethyl)piperidin-1-yl]sulfonyl-N,N,2-trimethylaniline.
| Compound Name | 5-[2-(1-aminoethyl)piperidin-1-yl]sulfonyl-N,N,2-trimethylaniline |
|---|---|
| PubChem CID | 119965411 |
| Molecular Formula | C16H27N3O2S |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 5-[2-(1-aminoethyl)piperidin-1-yl]sulfonyl-N,N,2-trimethylaniline |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2C(C)N)cc1N(C)C |
| InChI | InChI=1S/C16H27N3O2S/c1-12-8-9-14(11-16(12)18(3)4)22(20,21)19-10-6-5-7-15(19)13(2)17/h8-9,11,13,15H,5-7,10,17H2,1-4H3 |
| InChIKey | IFDSQDUGECLEHG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |