C11H15Br2NO3S2 — CID 116636696
[1-(2,5-dibromothiophen-3-yl)sulfonylazepan-2-yl]methanol (PubChem CID 116636696) has the molecular formula C11H15Br2NO3S2 and a molecular weight of 433.19 g/mol. Its IUPAC name is [1-(2,5-dibromothiophen-3-yl)sulfonylazepan-2-yl]methanol.
| Compound Name | [1-(2,5-dibromothiophen-3-yl)sulfonylazepan-2-yl]methanol |
|---|---|
| PubChem CID | 116636696 |
| Molecular Formula | C11H15Br2NO3S2 |
| Molecular Weight | 433.19 g/mol |
| Exact Mass | 430.89 |
| IUPAC Name | [1-(2,5-dibromothiophen-3-yl)sulfonylazepan-2-yl]methanol |
| SMILES | O=S(=O)(c1cc(Br)sc1Br)N1CCCCCC1CO |
| InChI | InChI=1S/C11H15Br2NO3S2/c12-10-6-9(11(13)18-10)19(16,17)14-5-3-1-2-4-8(14)7-15/h6,8,15H,1-5,7H2 |
| InChIKey | JVCQICSMMXYFEE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.19 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |