C12H24N2O2S — CID 97449155
(6R)-2-propan-2-ylsulfonyl-2,8-diazaspiro[5.5]undecane (PubChem CID 97449155) has the molecular formula C12H24N2O2S and a molecular weight of 260.40 g/mol. Its IUPAC name is (6R)-2-propan-2-ylsulfonyl-2,8-diazaspiro[5.5]undecane.
| Compound Name | (6R)-2-propan-2-ylsulfonyl-2,8-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 97449155 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | (6R)-2-propan-2-ylsulfonyl-2,8-diazaspiro[5.5]undecane |
| SMILES | CC(C)S(=O)(=O)N1CCC[C@@]2(CCCNC2)C1 |
| InChI | InChI=1S/C12H24N2O2S/c1-11(2)17(15,16)14-8-4-6-12(10-14)5-3-7-13-9-12/h11,13H,3-10H2,1-2H3/t12-/m1/s1 |
| InChIKey | KZCCEBPIODHWBU-GFCCVEGCSA-N |
| XLogP | 1.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |