C10H19NO4S — CID 63135913
3-methyl-1-propan-2-ylsulfonylpiperidine-3-carboxylic acid (PubChem CID 63135913) has the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. Its IUPAC name is 3-methyl-1-propan-2-ylsulfonylpiperidine-3-carboxylic acid.
| Compound Name | 3-methyl-1-propan-2-ylsulfonylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63135913 |
| Molecular Formula | C10H19NO4S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 3-methyl-1-propan-2-ylsulfonylpiperidine-3-carboxylic acid |
| SMILES | CC(C)S(=O)(=O)N1CCCC(C)(C(=O)O)C1 |
| InChI | InChI=1S/C10H19NO4S/c1-8(2)16(14,15)11-6-4-5-10(3,7-11)9(12)13/h8H,4-7H2,1-3H3,(H,12,13) |
| InChIKey | OZQFBNYWFYZRNU-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |