C8H13F2NO4S — CID 63136084
1-(difluoromethylsulfonyl)-3-methylpiperidine-3-carboxylic acid (PubChem CID 63136084) has the molecular formula C8H13F2NO4S and a molecular weight of 257.26 g/mol. Its IUPAC name is 1-(difluoromethylsulfonyl)-3-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-(difluoromethylsulfonyl)-3-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63136084 |
| Molecular Formula | C8H13F2NO4S |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 1-(difluoromethylsulfonyl)-3-methylpiperidine-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CCCN(S(=O)(=O)C(F)F)C1 |
| InChI | InChI=1S/C8H13F2NO4S/c1-8(6(12)13)3-2-4-11(5-8)16(14,15)7(9)10/h7H,2-5H2,1H3,(H,12,13) |
| InChIKey | ZRNKXZVLGUMUPB-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |