About 1-(2,2-difluoroethyl)-3-methylpiperidine-3-carboxylic acid
1-(2,2-difluoroethyl)-3-methylpiperidine-3-carboxylic acid (PubChem CID 63137075) has the molecular formula C9H15F2NO2
and a molecular weight of 207.22 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-methylpiperidine-3-carboxylic acid.
Analyze 1-(2,2-difluoroethyl)-3-methylpiperidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoroethyl)-3-methylpiperidine-3-carboxylic acid?
The IUPAC name of 1-(2,2-difluoroethyl)-3-methylpiperidine-3-carboxylic acid (CID 63137075) is 1-(2,2-difluoroethyl)-3-methylpiperidine-3-carboxylic acid.
What is the SMILES notation for 1-(2,2-difluoroethyl)-3-methylpiperidine-3-carboxylic acid?
The canonical SMILES for 1-(2,2-difluoroethyl)-3-methylpiperidine-3-carboxylic acid is CC1(C(=O)O)CCCN(CC(F)F)C1.
What is the InChIKey of 1-(2,2-difluoroethyl)-3-methylpiperidine-3-carboxylic acid?
The InChIKey is WUVPYSKZEPMGAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F2NO2/c1-9(8(13)14)3-2-4-12(6-9)5-7(10)11/h7H,2-6H2,1H3,(H,13,14).
What are the key properties of 1-(2,2-difluoroethyl)-3-methylpiperidine-3-carboxylic acid?
1-(2,2-difluoroethyl)-3-methylpiperidine-3-carboxylic acid has a molecular weight of 207.22 g/mol, XLogP of 1.44, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoroethyl)-3-methylpiperidine-3-carboxylic acid is sourced from PubChem (CID 63137075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).