C12H23NO2 — CID 65064170
1-(2-ethylbutyl)-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 65064170) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 1-(2-ethylbutyl)-3-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-(2-ethylbutyl)-3-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 65064170 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 1-(2-ethylbutyl)-3-methylpyrrolidine-3-carboxylic acid |
| SMILES | CCC(CC)CN1CCC(C)(C(=O)O)C1 |
| InChI | InChI=1S/C12H23NO2/c1-4-10(5-2)8-13-7-6-12(3,9-13)11(14)15/h10H,4-9H2,1-3H3,(H,14,15) |
| InChIKey | MZVJREQEINDEBS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |