C6H11F2NO2S — CID 131089160
1-(difluoromethylsulfonyl)-3,3-dimethylazetidine (PubChem CID 131089160) has the molecular formula C6H11F2NO2S and a molecular weight of 199.22 g/mol. Its IUPAC name is 1-(difluoromethylsulfonyl)-3,3-dimethylazetidine.
| Compound Name | 1-(difluoromethylsulfonyl)-3,3-dimethylazetidine |
|---|---|
| PubChem CID | 131089160 |
| Molecular Formula | C6H11F2NO2S |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 1-(difluoromethylsulfonyl)-3,3-dimethylazetidine |
| SMILES | CC1(C)CN(S(=O)(=O)C(F)F)C1 |
| InChI | InChI=1S/C6H11F2NO2S/c1-6(2)3-9(4-6)12(10,11)5(7)8/h5H,3-4H2,1-2H3 |
| InChIKey | SLZXIZNQKQSLSJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |