C8H16F2N2O2S — CID 115304771
1-(difluoromethylsulfonyl)-N,4-dimethylpiperidin-4-amine (PubChem CID 115304771) has the molecular formula C8H16F2N2O2S and a molecular weight of 242.29 g/mol. Its IUPAC name is 1-(difluoromethylsulfonyl)-N,4-dimethylpiperidin-4-amine.
| Compound Name | 1-(difluoromethylsulfonyl)-N,4-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 115304771 |
| Molecular Formula | C8H16F2N2O2S |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 1-(difluoromethylsulfonyl)-N,4-dimethylpiperidin-4-amine |
| SMILES | CNC1(C)CCN(S(=O)(=O)C(F)F)CC1 |
| InChI | InChI=1S/C8H16F2N2O2S/c1-8(11-2)3-5-12(6-4-8)15(13,14)7(9)10/h7,11H,3-6H2,1-2H3 |
| InChIKey | JQDHQNCAICSVCG-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |