C12H26N2O2S — CID 115304752
1-(2,2-dimethylpropylsulfonyl)-N,4-dimethylpiperidin-4-amine (PubChem CID 115304752) has the molecular formula C12H26N2O2S and a molecular weight of 262.42 g/mol. Its IUPAC name is 1-(2,2-dimethylpropylsulfonyl)-N,4-dimethylpiperidin-4-amine.
| Compound Name | 1-(2,2-dimethylpropylsulfonyl)-N,4-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 115304752 |
| Molecular Formula | C12H26N2O2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-(2,2-dimethylpropylsulfonyl)-N,4-dimethylpiperidin-4-amine |
| SMILES | CNC1(C)CCN(S(=O)(=O)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C12H26N2O2S/c1-11(2,3)10-17(15,16)14-8-6-12(4,13-5)7-9-14/h13H,6-10H2,1-5H3 |
| InChIKey | JRVSDOOXGAWVIM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |