C12H25NO3S — CID 106837151
1-[1-(2,2-dimethylpropylsulfonyl)piperidin-4-yl]ethanol (PubChem CID 106837151) has the molecular formula C12H25NO3S and a molecular weight of 263.40 g/mol. Its IUPAC name is 1-[1-(2,2-dimethylpropylsulfonyl)piperidin-4-yl]ethanol.
| Compound Name | 1-[1-(2,2-dimethylpropylsulfonyl)piperidin-4-yl]ethanol |
|---|---|
| PubChem CID | 106837151 |
| Molecular Formula | C12H25NO3S |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 1-[1-(2,2-dimethylpropylsulfonyl)piperidin-4-yl]ethanol |
| SMILES | CC(O)C1CCN(S(=O)(=O)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C12H25NO3S/c1-10(14)11-5-7-13(8-6-11)17(15,16)9-12(2,3)4/h10-11,14H,5-9H2,1-4H3 |
| InChIKey | XAQHHFYNZAEEHB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |