C12H24N2O2S — CID 115314221
3-(2,2-dimethylpropylsulfonyl)-3,9-diazabicyclo[4.2.1]nonane (PubChem CID 115314221) has the molecular formula C12H24N2O2S and a molecular weight of 260.40 g/mol. Its IUPAC name is 3-(2,2-dimethylpropylsulfonyl)-3,9-diazabicyclo[4.2.1]nonane.
| Compound Name | 3-(2,2-dimethylpropylsulfonyl)-3,9-diazabicyclo[4.2.1]nonane |
|---|---|
| PubChem CID | 115314221 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 3-(2,2-dimethylpropylsulfonyl)-3,9-diazabicyclo[4.2.1]nonane |
| SMILES | CC(C)(C)CS(=O)(=O)N1CCC2CCC(C1)N2 |
| InChI | InChI=1S/C12H24N2O2S/c1-12(2,3)9-17(15,16)14-7-6-10-4-5-11(8-14)13-10/h10-11,13H,4-9H2,1-3H3 |
| InChIKey | OAFDYUXDIWVYAX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |