C12H19NO5S — CID 112562241
5-(2,2-dimethylpropylsulfonyl)-4,6,7,7a-tetrahydro-3aH-furo[3,4-c]pyridine-1,3-dione (PubChem CID 112562241) has the molecular formula C12H19NO5S and a molecular weight of 289.35 g/mol. Its IUPAC name is 5-(2,2-dimethylpropylsulfonyl)-4,6,7,7a-tetrahydro-3aH-furo[3,4-c]pyridine-1,3-dione.
| Compound Name | 5-(2,2-dimethylpropylsulfonyl)-4,6,7,7a-tetrahydro-3aH-furo[3,4-c]pyridine-1,3-dione |
|---|---|
| PubChem CID | 112562241 |
| Molecular Formula | C12H19NO5S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 5-(2,2-dimethylpropylsulfonyl)-4,6,7,7a-tetrahydro-3aH-furo[3,4-c]pyridine-1,3-dione |
| SMILES | CC(C)(C)CS(=O)(=O)N1CCC2C(=O)OC(=O)C2C1 |
| InChI | InChI=1S/C12H19NO5S/c1-12(2,3)7-19(16,17)13-5-4-8-9(6-13)11(15)18-10(8)14/h8-9H,4-7H2,1-3H3 |
| InChIKey | WJRRRQMMOKPEKD-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|