C9H13NO7S2 — CID 112562237
5-(methylsulfonylmethylsulfonyl)-4,6,7,7a-tetrahydro-3aH-furo[3,4-c]pyridine-1,3-dione (PubChem CID 112562237) has the molecular formula C9H13NO7S2 and a molecular weight of 311.34 g/mol. Its IUPAC name is 5-(methylsulfonylmethylsulfonyl)-4,6,7,7a-tetrahydro-3aH-furo[3,4-c]pyridine-1,3-dione.
| Compound Name | 5-(methylsulfonylmethylsulfonyl)-4,6,7,7a-tetrahydro-3aH-furo[3,4-c]pyridine-1,3-dione |
|---|---|
| PubChem CID | 112562237 |
| Molecular Formula | C9H13NO7S2 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 5-(methylsulfonylmethylsulfonyl)-4,6,7,7a-tetrahydro-3aH-furo[3,4-c]pyridine-1,3-dione |
| SMILES | CS(=O)(=O)CS(=O)(=O)N1CCC2C(=O)OC(=O)C2C1 |
| InChI | InChI=1S/C9H13NO7S2/c1-18(13,14)5-19(15,16)10-3-2-6-7(4-10)9(12)17-8(6)11/h6-7H,2-5H2,1H3 |
| InChIKey | CQUFGZUGYDCBIS-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 114.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|