C10H14N2O7S — CID 114463033
ethyl N-[(1,3-dioxo-4,6,7,7a-tetrahydro-3aH-furo[3,4-c]pyridin-5-yl)sulfonyl]carbamate (PubChem CID 114463033) has the molecular formula C10H14N2O7S and a molecular weight of 306.30 g/mol. Its IUPAC name is ethyl N-[(1,3-dioxo-4,6,7,7a-tetrahydro-3aH-furo[3,4-c]pyridin-5-yl)sulfonyl]carbamate.
| Compound Name | ethyl N-[(1,3-dioxo-4,6,7,7a-tetrahydro-3aH-furo[3,4-c]pyridin-5-yl)sulfonyl]carbamate |
|---|---|
| PubChem CID | 114463033 |
| Molecular Formula | C10H14N2O7S |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | ethyl N-[(1,3-dioxo-4,6,7,7a-tetrahydro-3aH-furo[3,4-c]pyridin-5-yl)sulfonyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)N1CCC2C(=O)OC(=O)C2C1 |
| InChI | InChI=1S/C10H14N2O7S/c1-2-18-10(15)11-20(16,17)12-4-3-6-7(5-12)9(14)19-8(6)13/h6-7H,2-5H2,1H3,(H,11,15) |
| InChIKey | GJHZAHQXKKHIJA-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|