C9H19N3O5S — CID 114465185
ethyl N-[2-(methylaminomethyl)morpholin-4-yl]sulfonylcarbamate (PubChem CID 114465185) has the molecular formula C9H19N3O5S and a molecular weight of 281.33 g/mol. Its IUPAC name is ethyl N-[2-(methylaminomethyl)morpholin-4-yl]sulfonylcarbamate.
| Compound Name | ethyl N-[2-(methylaminomethyl)morpholin-4-yl]sulfonylcarbamate |
|---|---|
| PubChem CID | 114465185 |
| Molecular Formula | C9H19N3O5S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | ethyl N-[2-(methylaminomethyl)morpholin-4-yl]sulfonylcarbamate |
| SMILES | CCOC(=O)NS(=O)(=O)N1CCOC(CNC)C1 |
| InChI | InChI=1S/C9H19N3O5S/c1-3-16-9(13)11-18(14,15)12-4-5-17-8(7-12)6-10-2/h8,10H,3-7H2,1-2H3,(H,11,13) |
| InChIKey | JZLSLIUBCMRLCO-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |