C8H16N2O6S — CID 170435077
[7-(methoxymethyl)-1,4-oxazepan-4-yl]sulfonylcarbamic acid (PubChem CID 170435077) has the molecular formula C8H16N2O6S and a molecular weight of 268.29 g/mol. Its IUPAC name is [7-(methoxymethyl)-1,4-oxazepan-4-yl]sulfonylcarbamic acid.
| Compound Name | [7-(methoxymethyl)-1,4-oxazepan-4-yl]sulfonylcarbamic acid |
|---|---|
| PubChem CID | 170435077 |
| Molecular Formula | C8H16N2O6S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | [7-(methoxymethyl)-1,4-oxazepan-4-yl]sulfonylcarbamic acid |
| SMILES | COCC1CCN(S(=O)(=O)NC(=O)O)CCO1 |
| InChI | InChI=1S/C8H16N2O6S/c1-15-6-7-2-3-10(4-5-16-7)17(13,14)9-8(11)12/h7,9H,2-6H2,1H3,(H,11,12) |
| InChIKey | VVICGNAYEIKGIF-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |