C11H21N3O4S — CID 114465316
ethyl N-[(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)sulfonyl]carbamate (PubChem CID 114465316) has the molecular formula C11H21N3O4S and a molecular weight of 291.37 g/mol. Its IUPAC name is ethyl N-[(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)sulfonyl]carbamate.
| Compound Name | ethyl N-[(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)sulfonyl]carbamate |
|---|---|
| PubChem CID | 114465316 |
| Molecular Formula | C11H21N3O4S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | ethyl N-[(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)sulfonyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)N1CC2CCCC(N)C2C1 |
| InChI | InChI=1S/C11H21N3O4S/c1-2-18-11(15)13-19(16,17)14-6-8-4-3-5-10(12)9(8)7-14/h8-10H,2-7,12H2,1H3,(H,13,15) |
| InChIKey | DSGUELGPVYHPCI-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |