C12H24ClN3O2S — CID 120583882
2-pyrrolidin-1-ylsulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride (PubChem CID 120583882) has the molecular formula C12H24ClN3O2S and a molecular weight of 309.86 g/mol. Its IUPAC name is 2-pyrrolidin-1-ylsulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride.
| Compound Name | 2-pyrrolidin-1-ylsulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride |
|---|---|
| PubChem CID | 120583882 |
| Molecular Formula | C12H24ClN3O2S |
| Molecular Weight | 309.86 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 2-pyrrolidin-1-ylsulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride |
| SMILES | Cl.NC1CCCC2CN(S(=O)(=O)N3CCCC3)CC12 |
| InChI | InChI=1S/C12H23N3O2S.ClH/c13-12-5-3-4-10-8-15(9-11(10)12)18(16,17)14-6-1-2-7-14;/h10-12H,1-9,13H2;1H |
| InChIKey | JHOPIHLGLMWKIB-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.86 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |