C10H21N3O2S — CID 63872906
3,5-dimethyl-1-pyrrolidin-1-ylsulfonylpiperazine (PubChem CID 63872906) has the molecular formula C10H21N3O2S and a molecular weight of 247.36 g/mol. Its IUPAC name is 3,5-dimethyl-1-pyrrolidin-1-ylsulfonylpiperazine.
| Compound Name | 3,5-dimethyl-1-pyrrolidin-1-ylsulfonylpiperazine |
|---|---|
| PubChem CID | 63872906 |
| Molecular Formula | C10H21N3O2S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 3,5-dimethyl-1-pyrrolidin-1-ylsulfonylpiperazine |
| SMILES | CC1CN(S(=O)(=O)N2CCCC2)CC(C)N1 |
| InChI | InChI=1S/C10H21N3O2S/c1-9-7-13(8-10(2)11-9)16(14,15)12-5-3-4-6-12/h9-11H,3-8H2,1-2H3 |
| InChIKey | ZHTPWYJJTQZYIW-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |