C8H18N2O2S — CID 131076534
(3R,5S)-1-ethylsulfonyl-3,5-dimethylpiperazine (PubChem CID 131076534) has the molecular formula C8H18N2O2S and a molecular weight of 206.31 g/mol. Its IUPAC name is (3R,5S)-1-ethylsulfonyl-3,5-dimethylpiperazine.
| Compound Name | (3R,5S)-1-ethylsulfonyl-3,5-dimethylpiperazine |
|---|---|
| PubChem CID | 131076534 |
| Molecular Formula | C8H18N2O2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (3R,5S)-1-ethylsulfonyl-3,5-dimethylpiperazine |
| SMILES | CCS(=O)(=O)N1C[C@@H](C)N[C@@H](C)C1 |
| InChI | InChI=1S/C8H18N2O2S/c1-4-13(11,12)10-5-7(2)9-8(3)6-10/h7-9H,4-6H2,1-3H3/t7-,8+ |
| InChIKey | VPRHHDTZCBOXSP-OCAPTIKFSA-N |
| XLogP | 0.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |