C14H23ClN2O2S — CID 119980583
1-(4-ethylphenyl)sulfonyl-3,5-dimethylpiperazine;hydrochloride (PubChem CID 119980583) has the molecular formula C14H23ClN2O2S and a molecular weight of 318.87 g/mol. Its IUPAC name is 1-(4-ethylphenyl)sulfonyl-3,5-dimethylpiperazine;hydrochloride.
| Compound Name | 1-(4-ethylphenyl)sulfonyl-3,5-dimethylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 119980583 |
| Molecular Formula | C14H23ClN2O2S |
| Molecular Weight | 318.87 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 1-(4-ethylphenyl)sulfonyl-3,5-dimethylpiperazine;hydrochloride |
| SMILES | CCc1ccc(S(=O)(=O)N2CC(C)NC(C)C2)cc1.Cl |
| InChI | InChI=1S/C14H22N2O2S.ClH/c1-4-13-5-7-14(8-6-13)19(17,18)16-9-11(2)15-12(3)10-16;/h5-8,11-12,15H,4,9-10H2,1-3H3;1H |
| InChIKey | FQCPFGGFPSPHFJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.87 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |