C12H19ClN2O2S — CID 119993597
(3S)-1-(4-ethylphenyl)sulfonylpyrrolidin-3-amine;hydrochloride (PubChem CID 119993597) has the molecular formula C12H19ClN2O2S and a molecular weight of 290.82 g/mol. Its IUPAC name is (3S)-1-(4-ethylphenyl)sulfonylpyrrolidin-3-amine;hydrochloride.
| Compound Name | (3S)-1-(4-ethylphenyl)sulfonylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119993597 |
| Molecular Formula | C12H19ClN2O2S |
| Molecular Weight | 290.82 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (3S)-1-(4-ethylphenyl)sulfonylpyrrolidin-3-amine;hydrochloride |
| SMILES | CCc1ccc(S(=O)(=O)N2CC[C@H](N)C2)cc1.Cl |
| InChI | InChI=1S/C12H18N2O2S.ClH/c1-2-10-3-5-12(6-4-10)17(15,16)14-8-7-11(13)9-14;/h3-6,11H,2,7-9,13H2,1H3;1H/t11-;/m0./s1 |
| InChIKey | RGTFKXSMJZDXEA-MERQFXBCSA-N |
| XLogP | 1.39 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.82 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |