C11H18ClN3O4S2 — CID 120999160
4-[(3R)-3-aminopyrrolidin-1-yl]sulfonyl-N-methylbenzenesulfonamide;hydrochloride (PubChem CID 120999160) has the molecular formula C11H18ClN3O4S2 and a molecular weight of 355.87 g/mol. Its IUPAC name is 4-[(3R)-3-aminopyrrolidin-1-yl]sulfonyl-N-methylbenzenesulfonamide;hydrochloride.
| Compound Name | 4-[(3R)-3-aminopyrrolidin-1-yl]sulfonyl-N-methylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120999160 |
| Molecular Formula | C11H18ClN3O4S2 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 4-[(3R)-3-aminopyrrolidin-1-yl]sulfonyl-N-methylbenzenesulfonamide;hydrochloride |
| SMILES | CNS(=O)(=O)c1ccc(S(=O)(=O)N2CC[C@@H](N)C2)cc1.Cl |
| InChI | InChI=1S/C11H17N3O4S2.ClH/c1-13-19(15,16)10-2-4-11(5-3-10)20(17,18)14-7-6-9(12)8-14;/h2-5,9,13H,6-8,12H2,1H3;1H/t9-;/m1./s1 |
| InChIKey | FSWODVPJXFRVPJ-SBSPUUFOSA-N |
| XLogP | -0.26 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |