C14H21N3O4S2 — CID 119959258
4-(4-aminopiperidin-1-yl)sulfonyl-N-cyclopropylbenzenesulfonamide (PubChem CID 119959258) has the molecular formula C14H21N3O4S2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 4-(4-aminopiperidin-1-yl)sulfonyl-N-cyclopropylbenzenesulfonamide.
| Compound Name | 4-(4-aminopiperidin-1-yl)sulfonyl-N-cyclopropylbenzenesulfonamide |
|---|---|
| PubChem CID | 119959258 |
| Molecular Formula | C14H21N3O4S2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 4-(4-aminopiperidin-1-yl)sulfonyl-N-cyclopropylbenzenesulfonamide |
| SMILES | NC1CCN(S(=O)(=O)c2ccc(S(=O)(=O)NC3CC3)cc2)CC1 |
| InChI | InChI=1S/C14H21N3O4S2/c15-11-7-9-17(10-8-11)23(20,21)14-5-3-13(4-6-14)22(18,19)16-12-1-2-12/h3-6,11-12,16H,1-2,7-10,15H2 |
| InChIKey | ZYBGPGYTRNRZNB-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |