C11H25N3O2S — CID 63873091
N-butyl-N,3,5-trimethylpiperazine-1-sulfonamide (PubChem CID 63873091) has the molecular formula C11H25N3O2S and a molecular weight of 263.41 g/mol. Its IUPAC name is N-butyl-N,3,5-trimethylpiperazine-1-sulfonamide.
| Compound Name | N-butyl-N,3,5-trimethylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 63873091 |
| Molecular Formula | C11H25N3O2S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N-butyl-N,3,5-trimethylpiperazine-1-sulfonamide |
| SMILES | CCCCN(C)S(=O)(=O)N1CC(C)NC(C)C1 |
| InChI | InChI=1S/C11H25N3O2S/c1-5-6-7-13(4)17(15,16)14-8-10(2)12-11(3)9-14/h10-12H,5-9H2,1-4H3 |
| InChIKey | BJDNLEZGUBZULV-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |