C9H20N2O2S — CID 110662378
4-ethylsulfonyl-1,2,6-trimethylpiperazine (PubChem CID 110662378) has the molecular formula C9H20N2O2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 4-ethylsulfonyl-1,2,6-trimethylpiperazine.
| Compound Name | 4-ethylsulfonyl-1,2,6-trimethylpiperazine |
|---|---|
| PubChem CID | 110662378 |
| Molecular Formula | C9H20N2O2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 4-ethylsulfonyl-1,2,6-trimethylpiperazine |
| SMILES | CCS(=O)(=O)N1CC(C)N(C)C(C)C1 |
| InChI | InChI=1S/C9H20N2O2S/c1-5-14(12,13)11-6-8(2)10(4)9(3)7-11/h8-9H,5-7H2,1-4H3 |
| InChIKey | DTYCQOKXMYQOAD-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |