C11H23ClN2O2S — CID 114539403
4-(4-chlorobutylsulfonyl)-1,2,6-trimethylpiperazine (PubChem CID 114539403) has the molecular formula C11H23ClN2O2S and a molecular weight of 282.84 g/mol. Its IUPAC name is 4-(4-chlorobutylsulfonyl)-1,2,6-trimethylpiperazine.
| Compound Name | 4-(4-chlorobutylsulfonyl)-1,2,6-trimethylpiperazine |
|---|---|
| PubChem CID | 114539403 |
| Molecular Formula | C11H23ClN2O2S |
| Molecular Weight | 282.84 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 4-(4-chlorobutylsulfonyl)-1,2,6-trimethylpiperazine |
| SMILES | CC1CN(S(=O)(=O)CCCCCl)CC(C)N1C |
| InChI | InChI=1S/C11H23ClN2O2S/c1-10-8-14(9-11(2)13(10)3)17(15,16)7-5-4-6-12/h10-11H,4-9H2,1-3H3 |
| InChIKey | GBNHPDNUJYOCHI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.84 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|