C11H21ClN2O3S — CID 116814717
1-(4-chlorobutylsulfonyl)-N-methylpiperidine-4-carboxamide (PubChem CID 116814717) has the molecular formula C11H21ClN2O3S and a molecular weight of 296.82 g/mol. Its IUPAC name is 1-(4-chlorobutylsulfonyl)-N-methylpiperidine-4-carboxamide.
| Compound Name | 1-(4-chlorobutylsulfonyl)-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 116814717 |
| Molecular Formula | C11H21ClN2O3S |
| Molecular Weight | 296.82 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 1-(4-chlorobutylsulfonyl)-N-methylpiperidine-4-carboxamide |
| SMILES | CNC(=O)C1CCN(S(=O)(=O)CCCCCl)CC1 |
| InChI | InChI=1S/C11H21ClN2O3S/c1-13-11(15)10-4-7-14(8-5-10)18(16,17)9-3-2-6-12/h10H,2-9H2,1H3,(H,13,15) |
| InChIKey | RDNUTBGBDXLJRS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.82 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|