C11H21ClN2O4S — CID 54877232
N-[1-(3-chloropropylsulfonyl)piperidin-4-yl]-2-methoxyacetamide (PubChem CID 54877232) has the molecular formula C11H21ClN2O4S and a molecular weight of 312.82 g/mol. Its IUPAC name is N-[1-(3-chloropropylsulfonyl)piperidin-4-yl]-2-methoxyacetamide.
| Compound Name | N-[1-(3-chloropropylsulfonyl)piperidin-4-yl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 54877232 |
| Molecular Formula | C11H21ClN2O4S |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-[1-(3-chloropropylsulfonyl)piperidin-4-yl]-2-methoxyacetamide |
| SMILES | COCC(=O)NC1CCN(S(=O)(=O)CCCCl)CC1 |
| InChI | InChI=1S/C11H21ClN2O4S/c1-18-9-11(15)13-10-3-6-14(7-4-10)19(16,17)8-2-5-12/h10H,2-9H2,1H3,(H,13,15) |
| InChIKey | YRJCAHVOIGYYHZ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|