C11H21ClN2O3S — CID 107651086
N-[1-(2-chloroethylsulfonyl)piperidin-4-yl]-2-methylpropanamide (PubChem CID 107651086) has the molecular formula C11H21ClN2O3S and a molecular weight of 296.82 g/mol. Its IUPAC name is N-[1-(2-chloroethylsulfonyl)piperidin-4-yl]-2-methylpropanamide.
| Compound Name | N-[1-(2-chloroethylsulfonyl)piperidin-4-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 107651086 |
| Molecular Formula | C11H21ClN2O3S |
| Molecular Weight | 296.82 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | N-[1-(2-chloroethylsulfonyl)piperidin-4-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NC1CCN(S(=O)(=O)CCCl)CC1 |
| InChI | InChI=1S/C11H21ClN2O3S/c1-9(2)11(15)13-10-3-6-14(7-4-10)18(16,17)8-5-12/h9-10H,3-8H2,1-2H3,(H,13,15) |
| InChIKey | XCZSKYUDQPYADX-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.82 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|