C12H23BrN2O3S — CID 61251555
2-bromo-N-(1-ethylsulfonylpiperidin-4-yl)-3-methylbutanamide (PubChem CID 61251555) has the molecular formula C12H23BrN2O3S and a molecular weight of 355.30 g/mol. Its IUPAC name is 2-bromo-N-(1-ethylsulfonylpiperidin-4-yl)-3-methylbutanamide.
| Compound Name | 2-bromo-N-(1-ethylsulfonylpiperidin-4-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 61251555 |
| Molecular Formula | C12H23BrN2O3S |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 2-bromo-N-(1-ethylsulfonylpiperidin-4-yl)-3-methylbutanamide |
| SMILES | CCS(=O)(=O)N1CCC(NC(=O)C(Br)C(C)C)CC1 |
| InChI | InChI=1S/C12H23BrN2O3S/c1-4-19(17,18)15-7-5-10(6-8-15)14-12(16)11(13)9(2)3/h9-11H,4-8H2,1-3H3,(H,14,16) |
| InChIKey | NAMOFZUALYPYIA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|