C11H26N4O2S — CID 114545497
N-(3-aminopropyl)-N,3,4,5-tetramethylpiperazine-1-sulfonamide (PubChem CID 114545497) has the molecular formula C11H26N4O2S and a molecular weight of 278.42 g/mol. Its IUPAC name is N-(3-aminopropyl)-N,3,4,5-tetramethylpiperazine-1-sulfonamide.
| Compound Name | N-(3-aminopropyl)-N,3,4,5-tetramethylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 114545497 |
| Molecular Formula | C11H26N4O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | N-(3-aminopropyl)-N,3,4,5-tetramethylpiperazine-1-sulfonamide |
| SMILES | CC1CN(S(=O)(=O)N(C)CCCN)CC(C)N1C |
| InChI | InChI=1S/C11H26N4O2S/c1-10-8-15(9-11(2)14(10)4)18(16,17)13(3)7-5-6-12/h10-11H,5-9,12H2,1-4H3 |
| InChIKey | OGDCEWYWRAMVJJ-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |