C12H26N4O2S — CID 61456581
N-(3-aminopropyl)-4-(cyclopropylmethyl)-N-methylpiperazine-1-sulfonamide (PubChem CID 61456581) has the molecular formula C12H26N4O2S and a molecular weight of 290.43 g/mol. Its IUPAC name is N-(3-aminopropyl)-4-(cyclopropylmethyl)-N-methylpiperazine-1-sulfonamide.
| Compound Name | N-(3-aminopropyl)-4-(cyclopropylmethyl)-N-methylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 61456581 |
| Molecular Formula | C12H26N4O2S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | N-(3-aminopropyl)-4-(cyclopropylmethyl)-N-methylpiperazine-1-sulfonamide |
| SMILES | CN(CCCN)S(=O)(=O)N1CCN(CC2CC2)CC1 |
| InChI | InChI=1S/C12H26N4O2S/c1-14(6-2-5-13)19(17,18)16-9-7-15(8-10-16)11-12-3-4-12/h12H,2-11,13H2,1H3 |
| InChIKey | GFQFCJKCNTWYJT-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |