C12H27N3O2S — CID 103495211
N-(3-aminopropyl)-N-methyl-4-propan-2-ylpiperidine-1-sulfonamide (PubChem CID 103495211) has the molecular formula C12H27N3O2S and a molecular weight of 277.43 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-methyl-4-propan-2-ylpiperidine-1-sulfonamide.
| Compound Name | N-(3-aminopropyl)-N-methyl-4-propan-2-ylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 103495211 |
| Molecular Formula | C12H27N3O2S |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N-(3-aminopropyl)-N-methyl-4-propan-2-ylpiperidine-1-sulfonamide |
| SMILES | CC(C)C1CCN(S(=O)(=O)N(C)CCCN)CC1 |
| InChI | InChI=1S/C12H27N3O2S/c1-11(2)12-5-9-15(10-6-12)18(16,17)14(3)8-4-7-13/h11-12H,4-10,13H2,1-3H3 |
| InChIKey | UAPOTYMXNVCISC-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |