C11H25N3O2S2 — CID 114238612
N-(3-aminopropyl)-N-methyl-4-methylsulfanylazepane-1-sulfonamide (PubChem CID 114238612) has the molecular formula C11H25N3O2S2 and a molecular weight of 295.47 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-methyl-4-methylsulfanylazepane-1-sulfonamide.
| Compound Name | N-(3-aminopropyl)-N-methyl-4-methylsulfanylazepane-1-sulfonamide |
|---|---|
| PubChem CID | 114238612 |
| Molecular Formula | C11H25N3O2S2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N-(3-aminopropyl)-N-methyl-4-methylsulfanylazepane-1-sulfonamide |
| SMILES | CSC1CCCN(S(=O)(=O)N(C)CCCN)CC1 |
| InChI | InChI=1S/C11H25N3O2S2/c1-13(8-4-7-12)18(15,16)14-9-3-5-11(17-2)6-10-14/h11H,3-10,12H2,1-2H3 |
| InChIKey | IWGMIQWEOYDHPF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |