C13H27N3O2S — CID 102726076
(4aR,8aR)-N-(3-aminopropyl)-N-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-sulfonamide (PubChem CID 102726076) has the molecular formula C13H27N3O2S and a molecular weight of 289.44 g/mol. Its IUPAC name is (4aR,8aR)-N-(3-aminopropyl)-N-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-sulfonamide.
| Compound Name | (4aR,8aR)-N-(3-aminopropyl)-N-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-sulfonamide |
|---|---|
| PubChem CID | 102726076 |
| Molecular Formula | C13H27N3O2S |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | (4aR,8aR)-N-(3-aminopropyl)-N-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-sulfonamide |
| SMILES | CN(CCCN)S(=O)(=O)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C13H27N3O2S/c1-15(10-5-9-14)19(17,18)16-11-4-7-12-6-2-3-8-13(12)16/h12-13H,2-11,14H2,1H3/t12-,13-/m1/s1 |
| InChIKey | JPYBACOZPXFJCS-CHWSQXEVSA-N |
| XLogP | 1.17 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |