C11H24N2O2S — CID 128927637
N-butyl-N,2-dimethylpiperidine-1-sulfonamide (PubChem CID 128927637) has the molecular formula C11H24N2O2S and a molecular weight of 248.39 g/mol. Its IUPAC name is N-butyl-N,2-dimethylpiperidine-1-sulfonamide.
| Compound Name | N-butyl-N,2-dimethylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 128927637 |
| Molecular Formula | C11H24N2O2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | N-butyl-N,2-dimethylpiperidine-1-sulfonamide |
| SMILES | CCCCN(C)S(=O)(=O)N1CCCCC1C |
| InChI | InChI=1S/C11H24N2O2S/c1-4-5-9-12(3)16(14,15)13-10-7-6-8-11(13)2/h11H,4-10H2,1-3H3 |
| InChIKey | NDNCVMVESJIQML-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |