C10H20N2O5S — CID 114230140
1-[3-hydroxypropyl(methyl)sulfamoyl]piperidine-2-carboxylic acid (PubChem CID 114230140) has the molecular formula C10H20N2O5S and a molecular weight of 280.35 g/mol. Its IUPAC name is 1-[3-hydroxypropyl(methyl)sulfamoyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[3-hydroxypropyl(methyl)sulfamoyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 114230140 |
| Molecular Formula | C10H20N2O5S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 1-[3-hydroxypropyl(methyl)sulfamoyl]piperidine-2-carboxylic acid |
| SMILES | CN(CCCO)S(=O)(=O)N1CCCCC1C(=O)O |
| InChI | InChI=1S/C10H20N2O5S/c1-11(6-4-8-13)18(16,17)12-7-3-2-5-9(12)10(14)15/h9,13H,2-8H2,1H3,(H,14,15) |
| InChIKey | QUFMGJDXSUYFGF-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |