C17H32N2O2S — CID 100901387
(4aS,8aR)-N-cycloheptyl-N-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-sulfonamide (PubChem CID 100901387) has the molecular formula C17H32N2O2S and a molecular weight of 328.52 g/mol. Its IUPAC name is (4aS,8aR)-N-cycloheptyl-N-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-sulfonamide.
| Compound Name | (4aS,8aR)-N-cycloheptyl-N-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-sulfonamide |
|---|---|
| PubChem CID | 100901387 |
| Molecular Formula | C17H32N2O2S |
| Molecular Weight | 328.52 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (4aS,8aR)-N-cycloheptyl-N-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-sulfonamide |
| SMILES | CN(C1CCCCCC1)S(=O)(=O)N1CCC[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C17H32N2O2S/c1-18(16-11-4-2-3-5-12-16)22(20,21)19-14-8-10-15-9-6-7-13-17(15)19/h15-17H,2-14H2,1H3/t15-,17+/m0/s1 |
| InChIKey | ZGUZRCVNFBUXKZ-DOTOQJQBSA-N |
| XLogP | 3.54 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |