C10H22N4O3S — CID 54986272
1-[3-aminopropyl(methyl)sulfamoyl]-N-methylpyrrolidine-2-carboxamide (PubChem CID 54986272) has the molecular formula C10H22N4O3S and a molecular weight of 278.38 g/mol. Its IUPAC name is 1-[3-aminopropyl(methyl)sulfamoyl]-N-methylpyrrolidine-2-carboxamide.
| Compound Name | 1-[3-aminopropyl(methyl)sulfamoyl]-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 54986272 |
| Molecular Formula | C10H22N4O3S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 1-[3-aminopropyl(methyl)sulfamoyl]-N-methylpyrrolidine-2-carboxamide |
| SMILES | CNC(=O)C1CCCN1S(=O)(=O)N(C)CCCN |
| InChI | InChI=1S/C10H22N4O3S/c1-12-10(15)9-5-3-8-14(9)18(16,17)13(2)7-4-6-11/h9H,3-8,11H2,1-2H3,(H,12,15) |
| InChIKey | YFOZTJQQRUPDHE-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |