C11H25N3O3S — CID 107404128
N-(3-aminopropyl)-4-hydroxy-N,4-dimethylazepane-1-sulfonamide (PubChem CID 107404128) has the molecular formula C11H25N3O3S and a molecular weight of 279.41 g/mol. Its IUPAC name is N-(3-aminopropyl)-4-hydroxy-N,4-dimethylazepane-1-sulfonamide.
| Compound Name | N-(3-aminopropyl)-4-hydroxy-N,4-dimethylazepane-1-sulfonamide |
|---|---|
| PubChem CID | 107404128 |
| Molecular Formula | C11H25N3O3S |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N-(3-aminopropyl)-4-hydroxy-N,4-dimethylazepane-1-sulfonamide |
| SMILES | CN(CCCN)S(=O)(=O)N1CCCC(C)(O)CC1 |
| InChI | InChI=1S/C11H25N3O3S/c1-11(15)5-3-9-14(10-6-11)18(16,17)13(2)8-4-7-12/h15H,3-10,12H2,1-2H3 |
| InChIKey | JHEQDXMANBZCIU-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |