C11H25N3O2S2 — CID 114142578
1-[[3-aminopropyl(methyl)sulfamoyl]amino]-4-methylsulfanylcyclohexane (PubChem CID 114142578) has the molecular formula C11H25N3O2S2 and a molecular weight of 295.47 g/mol. Its IUPAC name is 1-[[3-aminopropyl(methyl)sulfamoyl]amino]-4-methylsulfanylcyclohexane.
| Compound Name | 1-[[3-aminopropyl(methyl)sulfamoyl]amino]-4-methylsulfanylcyclohexane |
|---|---|
| PubChem CID | 114142578 |
| Molecular Formula | C11H25N3O2S2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 1-[[3-aminopropyl(methyl)sulfamoyl]amino]-4-methylsulfanylcyclohexane |
| SMILES | CSC1CCC(NS(=O)(=O)N(C)CCCN)CC1 |
| InChI | InChI=1S/C11H25N3O2S2/c1-14(9-3-8-12)18(15,16)13-10-4-6-11(17-2)7-5-10/h10-11,13H,3-9,12H2,1-2H3 |
| InChIKey | ZPDNQORCUHWCLH-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |