C14H31N3O2S — CID 106058865
[[3-(ethylamino)propyl-methylsulfamoyl]amino]cyclooctane (PubChem CID 106058865) has the molecular formula C14H31N3O2S and a molecular weight of 305.49 g/mol. Its IUPAC name is [[3-(ethylamino)propyl-methylsulfamoyl]amino]cyclooctane.
| Compound Name | [[3-(ethylamino)propyl-methylsulfamoyl]amino]cyclooctane |
|---|---|
| PubChem CID | 106058865 |
| Molecular Formula | C14H31N3O2S |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | [[3-(ethylamino)propyl-methylsulfamoyl]amino]cyclooctane |
| SMILES | CCNCCCN(C)S(=O)(=O)NC1CCCCCCC1 |
| InChI | InChI=1S/C14H31N3O2S/c1-3-15-12-9-13-17(2)20(18,19)16-14-10-7-5-4-6-8-11-14/h14-16H,3-13H2,1-2H3 |
| InChIKey | CASHZWFXHUKWIT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|