C14H30N4O2S — CID 106074034
7-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 106074034) has the molecular formula C14H30N4O2S and a molecular weight of 318.49 g/mol. Its IUPAC name is 7-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | 7-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 106074034 |
| Molecular Formula | C14H30N4O2S |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 7-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | CCNCCCN(C)S(=O)(=O)NC1CCN2CCCC2C1 |
| InChI | InChI=1S/C14H30N4O2S/c1-3-15-8-5-9-17(2)21(19,20)16-13-7-11-18-10-4-6-14(18)12-13/h13-16H,3-12H2,1-2H3 |
| InChIKey | UHLZBXNYJWCFGI-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|