C14H28N4O2S — CID 79936068
N-[3-(cyclopropylamino)propyl]-N-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-sulfonamide (PubChem CID 79936068) has the molecular formula C14H28N4O2S and a molecular weight of 316.47 g/mol. Its IUPAC name is N-[3-(cyclopropylamino)propyl]-N-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-sulfonamide.
| Compound Name | N-[3-(cyclopropylamino)propyl]-N-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-sulfonamide |
|---|---|
| PubChem CID | 79936068 |
| Molecular Formula | C14H28N4O2S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | N-[3-(cyclopropylamino)propyl]-N-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-sulfonamide |
| SMILES | CN(CCCNC1CC1)S(=O)(=O)N1CCN2CCCC2C1 |
| InChI | InChI=1S/C14H28N4O2S/c1-16(8-3-7-15-13-5-6-13)21(19,20)18-11-10-17-9-2-4-14(17)12-18/h13-15H,2-12H2,1H3 |
| InChIKey | QZSDMOCIKUPBOI-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|